C26H27N3O5S — CID 46284165
methyl 4-[3-benzyl-7-(cyclopentylcarbamoyl)-4-oxoquinazolin-2-yl]sulfanyl-3-oxobutanoate (PubChem CID 46284165) has the molecular formula C26H27N3O5S and a molecular weight of 493.59 g/mol. Its IUPAC name is methyl 4-[3-benzyl-7-(cyclopentylcarbamoyl)-4-oxoquinazolin-2-yl]sulfanyl-3-oxobutanoate.
| Compound Name | methyl 4-[3-benzyl-7-(cyclopentylcarbamoyl)-4-oxoquinazolin-2-yl]sulfanyl-3-oxobutanoate |
|---|---|
| PubChem CID | 46284165 |
| Molecular Formula | C26H27N3O5S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | methyl 4-[3-benzyl-7-(cyclopentylcarbamoyl)-4-oxoquinazolin-2-yl]sulfanyl-3-oxobutanoate |
| SMILES | COC(=O)CC(=O)CSc1nc2cc(C(=O)NC3CCCC3)ccc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C26H27N3O5S/c1-34-23(31)14-20(30)16-35-26-28-22-13-18(24(32)27-19-9-5-6-10-19)11-12-21(22)25(33)29(26)15-17-7-3-2-4-8-17/h2-4,7-8,11-13,19H,5-6,9-10,14-16H2,1H3,(H,27,32) |
| InChIKey | KVWOUCVUUXYRCO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|