C26H31N3O5S — CID 46284218
2-[1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-N,3-bis(2-methoxyethyl)-4-oxoquinazoline-7-carboxamide (PubChem CID 46284218) has the molecular formula C26H31N3O5S and a molecular weight of 497.62 g/mol. Its IUPAC name is 2-[1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-N,3-bis(2-methoxyethyl)-4-oxoquinazoline-7-carboxamide.
| Compound Name | 2-[1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-N,3-bis(2-methoxyethyl)-4-oxoquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 46284218 |
| Molecular Formula | C26H31N3O5S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 2-[1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-N,3-bis(2-methoxyethyl)-4-oxoquinazoline-7-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(=O)n(CCOC)c(SC(C)C(=O)c3ccc(C)c(C)c3)nc2c1 |
| InChI | InChI=1S/C26H31N3O5S/c1-16-6-7-19(14-17(16)2)23(30)18(3)35-26-28-22-15-20(24(31)27-10-12-33-4)8-9-21(22)25(32)29(26)11-13-34-5/h6-9,14-15,18H,10-13H2,1-5H3,(H,27,31) |
| InChIKey | ZIOKULZNLCOHIX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|