C22H20ClN5O3 — CID 46285243
3-[(4-chlorobenzoyl)amino]-4-(4-pyrimidin-2-ylpiperazin-1-yl)benzoic acid (PubChem CID 46285243) has the molecular formula C22H20ClN5O3 and a molecular weight of 437.89 g/mol. Its IUPAC name is 3-[(4-chlorobenzoyl)amino]-4-(4-pyrimidin-2-ylpiperazin-1-yl)benzoic acid.
| Compound Name | 3-[(4-chlorobenzoyl)amino]-4-(4-pyrimidin-2-ylpiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 46285243 |
| Molecular Formula | C22H20ClN5O3 |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 3-[(4-chlorobenzoyl)amino]-4-(4-pyrimidin-2-ylpiperazin-1-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCN(c3ncccn3)CC2)c(NC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H20ClN5O3/c23-17-5-2-15(3-6-17)20(29)26-18-14-16(21(30)31)4-7-19(18)27-10-12-28(13-11-27)22-24-8-1-9-25-22/h1-9,14H,10-13H2,(H,26,29)(H,30,31) |
| InChIKey | SPLAVWHNPRITMG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |