C17H16F2N4O — CID 46287063
1-(2,4-difluorophenyl)-3-[2-(2-methylbenzimidazol-1-yl)ethyl]urea (PubChem CID 46287063) has the molecular formula C17H16F2N4O and a molecular weight of 330.34 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[2-(2-methylbenzimidazol-1-yl)ethyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[2-(2-methylbenzimidazol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 46287063 |
| Molecular Formula | C17H16F2N4O |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[2-(2-methylbenzimidazol-1-yl)ethyl]urea |
| SMILES | Cc1nc2ccccc2n1CCNC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H16F2N4O/c1-11-21-15-4-2-3-5-16(15)23(11)9-8-20-17(24)22-14-7-6-12(18)10-13(14)19/h2-7,10H,8-9H2,1H3,(H2,20,22,24) |
| InChIKey | AVYQNOGLKCBOMD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |