C25H22N4O — CID 112825397
1-[2-(2-methylbenzimidazol-1-yl)ethyl]-3-[3-(2-phenylethynyl)phenyl]urea (PubChem CID 112825397) has the molecular formula C25H22N4O and a molecular weight of 394.48 g/mol. Its IUPAC name is 1-[2-(2-methylbenzimidazol-1-yl)ethyl]-3-[3-(2-phenylethynyl)phenyl]urea.
| Compound Name | 1-[2-(2-methylbenzimidazol-1-yl)ethyl]-3-[3-(2-phenylethynyl)phenyl]urea |
|---|---|
| PubChem CID | 112825397 |
| Molecular Formula | C25H22N4O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 1-[2-(2-methylbenzimidazol-1-yl)ethyl]-3-[3-(2-phenylethynyl)phenyl]urea |
| SMILES | Cc1nc2ccccc2n1CCNC(=O)Nc1cccc(C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C25H22N4O/c1-19-27-23-12-5-6-13-24(23)29(19)17-16-26-25(30)28-22-11-7-10-21(18-22)15-14-20-8-3-2-4-9-20/h2-13,18H,16-17H2,1H3,(H2,26,28,30) |
| InChIKey | USJBYFAZHXCNQL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|