C17H17BrN4S — CID 9237587
1-(3-bromophenyl)-3-[2-(2-methylbenzimidazol-1-yl)ethyl]thiourea (PubChem CID 9237587) has the molecular formula C17H17BrN4S and a molecular weight of 389.32 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[2-(2-methylbenzimidazol-1-yl)ethyl]thiourea.
| Compound Name | 1-(3-bromophenyl)-3-[2-(2-methylbenzimidazol-1-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 9237587 |
| Molecular Formula | C17H17BrN4S |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 1-(3-bromophenyl)-3-[2-(2-methylbenzimidazol-1-yl)ethyl]thiourea |
| SMILES | Cc1nc2ccccc2n1CCNC(=S)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C17H17BrN4S/c1-12-20-15-7-2-3-8-16(15)22(12)10-9-19-17(23)21-14-6-4-5-13(18)11-14/h2-8,11H,9-10H2,1H3,(H2,19,21,23) |
| InChIKey | ZXUCKHLKJCWRNR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|