C22H24N4O2S3 — CID 46287721
N-[2-(cyclohexen-1-yl)ethyl]-2-[(6-methyl-7-oxo-3-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-5-yl)sulfanyl]acetamide (PubChem CID 46287721) has the molecular formula C22H24N4O2S3 and a molecular weight of 472.66 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[(6-methyl-7-oxo-3-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-5-yl)sulfanyl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(6-methyl-7-oxo-3-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 46287721 |
| Molecular Formula | C22H24N4O2S3 |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(6-methyl-7-oxo-3-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-5-yl)sulfanyl]acetamide |
| SMILES | Cn1c(SCC(=O)NCCC2=CCCCC2)nc2c(sc(=S)n2-c2ccccc2)c1=O |
| InChI | InChI=1S/C22H24N4O2S3/c1-25-20(28)18-19(26(22(29)31-18)16-10-6-3-7-11-16)24-21(25)30-14-17(27)23-13-12-15-8-4-2-5-9-15/h3,6-8,10-11H,2,4-5,9,12-14H2,1H3,(H,23,27) |
| InChIKey | VZEFYAHMNBENJD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|