C25H26N4O3S3 — CID 5015082
2-[[3-(3,4-dimethylphenyl)-7-oxo-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-5-yl]sulfanyl]-N-(3-methoxypropyl)acetamide (PubChem CID 5015082) has the molecular formula C25H26N4O3S3 and a molecular weight of 526.71 g/mol. Its IUPAC name is 2-[[3-(3,4-dimethylphenyl)-7-oxo-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-5-yl]sulfanyl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[[3-(3,4-dimethylphenyl)-7-oxo-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-5-yl]sulfanyl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 5015082 |
| Molecular Formula | C25H26N4O3S3 |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 2-[[3-(3,4-dimethylphenyl)-7-oxo-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-5-yl]sulfanyl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CSc1nc2c(sc(=S)n2-c2ccc(C)c(C)c2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C25H26N4O3S3/c1-16-10-11-19(14-17(16)2)28-22-21(35-25(28)33)23(31)29(18-8-5-4-6-9-18)24(27-22)34-15-20(30)26-12-7-13-32-3/h4-6,8-11,14H,7,12-13,15H2,1-3H3,(H,26,30) |
| InChIKey | QBYASDOVBBNPRF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|