C24H26N4O3 — CID 46287929
ethyl 4-[[3-(4-methylphenyl)cinnoline-4-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 46287929) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is ethyl 4-[[3-(4-methylphenyl)cinnoline-4-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[3-(4-methylphenyl)cinnoline-4-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46287929 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | ethyl 4-[[3-(4-methylphenyl)cinnoline-4-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2c(-c3ccc(C)cc3)nnc3ccccc23)CC1 |
| InChI | InChI=1S/C24H26N4O3/c1-3-31-24(30)28-14-12-18(13-15-28)25-23(29)21-19-6-4-5-7-20(19)26-27-22(21)17-10-8-16(2)9-11-17/h4-11,18H,3,12-15H2,1-2H3,(H,25,29) |
| InChIKey | SMWSONMKNATYCP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |