C23H32N4O2 — CID 46290155
N-[2-(cyclohexen-1-yl)ethyl]-1-(2,5,6-trimethylfuro[2,3-d]pyrimidin-4-yl)piperidine-4-carboxamide (PubChem CID 46290155) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-(2,5,6-trimethylfuro[2,3-d]pyrimidin-4-yl)piperidine-4-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-(2,5,6-trimethylfuro[2,3-d]pyrimidin-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46290155 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-(2,5,6-trimethylfuro[2,3-d]pyrimidin-4-yl)piperidine-4-carboxamide |
| SMILES | Cc1nc(N2CCC(C(=O)NCCC3=CCCCC3)CC2)c2c(C)c(C)oc2n1 |
| InChI | InChI=1S/C23H32N4O2/c1-15-16(2)29-23-20(15)21(25-17(3)26-23)27-13-10-19(11-14-27)22(28)24-12-9-18-7-5-4-6-8-18/h7,19H,4-6,8-14H2,1-3H3,(H,24,28) |
| InChIKey | LBIAOUQETWABNG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|