C22H19N3O3S2 — CID 46291220
N-[4-methyl-2-[(4-methylphenyl)sulfonylamino]-1,3-benzothiazol-6-yl]benzamide (PubChem CID 46291220) has the molecular formula C22H19N3O3S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is N-[4-methyl-2-[(4-methylphenyl)sulfonylamino]-1,3-benzothiazol-6-yl]benzamide.
| Compound Name | N-[4-methyl-2-[(4-methylphenyl)sulfonylamino]-1,3-benzothiazol-6-yl]benzamide |
|---|---|
| PubChem CID | 46291220 |
| Molecular Formula | C22H19N3O3S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | N-[4-methyl-2-[(4-methylphenyl)sulfonylamino]-1,3-benzothiazol-6-yl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2nc3c(C)cc(NC(=O)c4ccccc4)cc3s2)cc1 |
| InChI | InChI=1S/C22H19N3O3S2/c1-14-8-10-18(11-9-14)30(27,28)25-22-24-20-15(2)12-17(13-19(20)29-22)23-21(26)16-6-4-3-5-7-16/h3-13H,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | ULFGTHMLMUAWGM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |