C21H16FN3O3S2 — CID 46325627
N-[6-[(2-fluorophenyl)sulfonylamino]-4-methyl-1,3-benzothiazol-2-yl]benzamide (PubChem CID 46325627) has the molecular formula C21H16FN3O3S2 and a molecular weight of 441.51 g/mol. Its IUPAC name is N-[6-[(2-fluorophenyl)sulfonylamino]-4-methyl-1,3-benzothiazol-2-yl]benzamide.
| Compound Name | N-[6-[(2-fluorophenyl)sulfonylamino]-4-methyl-1,3-benzothiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 46325627 |
| Molecular Formula | C21H16FN3O3S2 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | N-[6-[(2-fluorophenyl)sulfonylamino]-4-methyl-1,3-benzothiazol-2-yl]benzamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccccc2F)cc2sc(NC(=O)c3ccccc3)nc12 |
| InChI | InChI=1S/C21H16FN3O3S2/c1-13-11-15(25-30(27,28)18-10-6-5-9-16(18)22)12-17-19(13)23-21(29-17)24-20(26)14-7-3-2-4-8-14/h2-12,25H,1H3,(H,23,24,26) |
| InChIKey | ZCOUTDMVQASVIU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |