C14H11ClN2O4S — CID 46292481
N-(3-chlorophenyl)-2-methyl-5-(1,2-oxazol-5-yl)furan-3-sulfonamide (PubChem CID 46292481) has the molecular formula C14H11ClN2O4S and a molecular weight of 338.77 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-methyl-5-(1,2-oxazol-5-yl)furan-3-sulfonamide.
| Compound Name | N-(3-chlorophenyl)-2-methyl-5-(1,2-oxazol-5-yl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 46292481 |
| Molecular Formula | C14H11ClN2O4S |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | N-(3-chlorophenyl)-2-methyl-5-(1,2-oxazol-5-yl)furan-3-sulfonamide |
| SMILES | Cc1oc(-c2ccno2)cc1S(=O)(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H11ClN2O4S/c1-9-14(8-13(20-9)12-5-6-16-21-12)22(18,19)17-11-4-2-3-10(15)7-11/h2-8,17H,1H3 |
| InChIKey | ZEVSKRGXSWEGFZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |