C25H29N5O3 — CID 46294030
N-[N-(3,5-dimethylphenyl)-N'-[(3-methyl-1-propylpyrazol-4-yl)methyl]carbamimidoyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 46294030) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-[N-(3,5-dimethylphenyl)-N'-[(3-methyl-1-propylpyrazol-4-yl)methyl]carbamimidoyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[N-(3,5-dimethylphenyl)-N'-[(3-methyl-1-propylpyrazol-4-yl)methyl]carbamimidoyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 46294030 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | N-[N-(3,5-dimethylphenyl)-N'-[(3-methyl-1-propylpyrazol-4-yl)methyl]carbamimidoyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CCCn1cc(C/N=C(\NC(=O)c2ccc3c(c2)OCO3)Nc2cc(C)cc(C)c2)c(C)n1 |
| InChI | InChI=1S/C25H29N5O3/c1-5-8-30-14-20(18(4)29-30)13-26-25(27-21-10-16(2)9-17(3)11-21)28-24(31)19-6-7-22-23(12-19)33-15-32-22/h6-7,9-12,14H,5,8,13,15H2,1-4H3,(H2,26,27,28,31) |
| InChIKey | ULTFXNIYDCBOJZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|