C25H30FN5O2 — CID 46294165
N-[N-(4-ethoxyphenyl)-N'-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]carbamimidoyl]-3-fluorobenzamide (PubChem CID 46294165) has the molecular formula C25H30FN5O2 and a molecular weight of 451.55 g/mol. Its IUPAC name is N-[N-(4-ethoxyphenyl)-N'-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]carbamimidoyl]-3-fluorobenzamide.
| Compound Name | N-[N-(4-ethoxyphenyl)-N'-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]carbamimidoyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 46294165 |
| Molecular Formula | C25H30FN5O2 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | N-[N-(4-ethoxyphenyl)-N'-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]carbamimidoyl]-3-fluorobenzamide |
| SMILES | CCOc1ccc(N/C(=N/CCc2c(C)nn(CC)c2C)NC(=O)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C25H30FN5O2/c1-5-31-18(4)23(17(3)30-31)14-15-27-25(28-21-10-12-22(13-11-21)33-6-2)29-24(32)19-8-7-9-20(26)16-19/h7-13,16H,5-6,14-15H2,1-4H3,(H2,27,28,29,32) |
| InChIKey | YSACIWFGFPHOIK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|