C25H31N5O — CID 46294276
N-[N'-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-N-(4-methylphenyl)carbamimidoyl]-3-methylbenzamide (PubChem CID 46294276) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is N-[N'-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-N-(4-methylphenyl)carbamimidoyl]-3-methylbenzamide.
| Compound Name | N-[N'-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-N-(4-methylphenyl)carbamimidoyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 46294276 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | N-[N'-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-N-(4-methylphenyl)carbamimidoyl]-3-methylbenzamide |
| SMILES | CCn1nc(C)c(CC/N=C(\NC(=O)c2cccc(C)c2)Nc2ccc(C)cc2)c1C |
| InChI | InChI=1S/C25H31N5O/c1-6-30-20(5)23(19(4)29-30)14-15-26-25(27-22-12-10-17(2)11-13-22)28-24(31)21-9-7-8-18(3)16-21/h7-13,16H,6,14-15H2,1-5H3,(H2,26,27,28,31) |
| InChIKey | NFHFONFLQKPMOA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|