C24H28ClN5O2 — CID 46294215
2-chloro-N-[N'-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-N-(3-methoxyphenyl)carbamimidoyl]benzamide (PubChem CID 46294215) has the molecular formula C24H28ClN5O2 and a molecular weight of 453.97 g/mol. Its IUPAC name is 2-chloro-N-[N'-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-N-(3-methoxyphenyl)carbamimidoyl]benzamide.
| Compound Name | 2-chloro-N-[N'-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-N-(3-methoxyphenyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 46294215 |
| Molecular Formula | C24H28ClN5O2 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 2-chloro-N-[N'-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-N-(3-methoxyphenyl)carbamimidoyl]benzamide |
| SMILES | CCn1nc(C)c(CC/N=C(\NC(=O)c2ccccc2Cl)Nc2cccc(OC)c2)c1C |
| InChI | InChI=1S/C24H28ClN5O2/c1-5-30-17(3)20(16(2)29-30)13-14-26-24(27-18-9-8-10-19(15-18)32-4)28-23(31)21-11-6-7-12-22(21)25/h6-12,15H,5,13-14H2,1-4H3,(H2,26,27,28,31) |
| InChIKey | FONJEMUAIZCEOQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|