C21H23FN2O2 — CID 46294982
2-(1-benzoylpiperidin-4-yl)-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 46294982) has the molecular formula C21H23FN2O2 and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-(1-benzoylpiperidin-4-yl)-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(1-benzoylpiperidin-4-yl)-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 46294982 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-(1-benzoylpiperidin-4-yl)-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | O=C(CC1CCN(C(=O)c2ccccc2)CC1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H23FN2O2/c22-19-8-6-17(7-9-19)15-23-20(25)14-16-10-12-24(13-11-16)21(26)18-4-2-1-3-5-18/h1-9,16H,10-15H2,(H,23,25) |
| InChIKey | QBXUVWAUSPHPLF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |