C23H16N2O3S — CID 46296986
4-[2-(4-methylbenzoyl)-1,1-dioxo-1λ6,4-benzothiazin-4-yl]benzonitrile (PubChem CID 46296986) has the molecular formula C23H16N2O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is 4-[2-(4-methylbenzoyl)-1,1-dioxo-1λ6,4-benzothiazin-4-yl]benzonitrile.
| Compound Name | 4-[2-(4-methylbenzoyl)-1,1-dioxo-1λ6,4-benzothiazin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 46296986 |
| Molecular Formula | C23H16N2O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 4-[2-(4-methylbenzoyl)-1,1-dioxo-1λ6,4-benzothiazin-4-yl]benzonitrile |
| SMILES | Cc1ccc(C(=O)C2=CN(c3ccc(C#N)cc3)c3ccccc3S2(=O)=O)cc1 |
| InChI | InChI=1S/C23H16N2O3S/c1-16-6-10-18(11-7-16)23(26)22-15-25(19-12-8-17(14-24)9-13-19)20-4-2-3-5-21(20)29(22,27)28/h2-13,15H,1H3 |
| InChIKey | IDVNQEHWNBDVET-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|