C18H17NO6S — CID 50927926
methyl 4-(3,4-dimethoxyphenyl)-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate (PubChem CID 50927926) has the molecular formula C18H17NO6S and a molecular weight of 375.40 g/mol. Its IUPAC name is methyl 4-(3,4-dimethoxyphenyl)-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate.
| Compound Name | methyl 4-(3,4-dimethoxyphenyl)-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate |
|---|---|
| PubChem CID | 50927926 |
| Molecular Formula | C18H17NO6S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | methyl 4-(3,4-dimethoxyphenyl)-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate |
| SMILES | COC(=O)C1=CN(c2ccc(OC)c(OC)c2)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C18H17NO6S/c1-23-14-9-8-12(10-15(14)24-2)19-11-17(18(20)25-3)26(21,22)16-7-5-4-6-13(16)19/h4-11H,1-3H3 |
| InChIKey | NNCSAAWOSXKEHP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|