C18H16BrNO6S — CID 53009398
methyl 6-bromo-4-(3,5-dimethoxyphenyl)-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate (PubChem CID 53009398) has the molecular formula C18H16BrNO6S and a molecular weight of 454.30 g/mol. Its IUPAC name is methyl 6-bromo-4-(3,5-dimethoxyphenyl)-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate.
| Compound Name | methyl 6-bromo-4-(3,5-dimethoxyphenyl)-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate |
|---|---|
| PubChem CID | 53009398 |
| Molecular Formula | C18H16BrNO6S |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | methyl 6-bromo-4-(3,5-dimethoxyphenyl)-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate |
| SMILES | COC(=O)C1=CN(c2cc(OC)cc(OC)c2)c2cc(Br)ccc2S1(=O)=O |
| InChI | InChI=1S/C18H16BrNO6S/c1-24-13-7-12(8-14(9-13)25-2)20-10-17(18(21)26-3)27(22,23)16-5-4-11(19)6-15(16)20/h4-10H,1-3H3 |
| InChIKey | AHYQSUQKHBBBQC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|