C18H15ClFNO5S — CID 53094613
methyl 4-(4-chloro-2-methoxy-5-methylphenyl)-6-fluoro-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate (PubChem CID 53094613) has the molecular formula C18H15ClFNO5S and a molecular weight of 411.84 g/mol. Its IUPAC name is methyl 4-(4-chloro-2-methoxy-5-methylphenyl)-6-fluoro-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate.
| Compound Name | methyl 4-(4-chloro-2-methoxy-5-methylphenyl)-6-fluoro-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate |
|---|---|
| PubChem CID | 53094613 |
| Molecular Formula | C18H15ClFNO5S |
| Molecular Weight | 411.84 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | methyl 4-(4-chloro-2-methoxy-5-methylphenyl)-6-fluoro-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate |
| SMILES | COC(=O)C1=CN(c2cc(C)c(Cl)cc2OC)c2cc(F)ccc2S1(=O)=O |
| InChI | InChI=1S/C18H15ClFNO5S/c1-10-6-13(15(25-2)8-12(10)19)21-9-17(18(22)26-3)27(23,24)16-5-4-11(20)7-14(16)21/h4-9H,1-3H3 |
| InChIKey | BCIMZGTYIHVLND-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.84 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|