C17H13BrFNO4S — CID 50927961
methyl 4-(4-bromo-3-methylphenyl)-6-fluoro-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate (PubChem CID 50927961) has the molecular formula C17H13BrFNO4S and a molecular weight of 426.26 g/mol. Its IUPAC name is methyl 4-(4-bromo-3-methylphenyl)-6-fluoro-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate.
| Compound Name | methyl 4-(4-bromo-3-methylphenyl)-6-fluoro-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate |
|---|---|
| PubChem CID | 50927961 |
| Molecular Formula | C17H13BrFNO4S |
| Molecular Weight | 426.26 g/mol |
| Exact Mass | 424.97 |
| IUPAC Name | methyl 4-(4-bromo-3-methylphenyl)-6-fluoro-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate |
| SMILES | COC(=O)C1=CN(c2ccc(Br)c(C)c2)c2cc(F)ccc2S1(=O)=O |
| InChI | InChI=1S/C17H13BrFNO4S/c1-10-7-12(4-5-13(10)18)20-9-16(17(21)24-2)25(22,23)15-6-3-11(19)8-14(15)20/h3-9H,1-2H3 |
| InChIKey | GYXBBLWHKBAAKH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|