C19H18FNO4S — CID 50927970
methyl 7-fluoro-1,1-dioxo-4-(4-propan-2-ylphenyl)-1λ6,4-benzothiazine-2-carboxylate (PubChem CID 50927970) has the molecular formula C19H18FNO4S and a molecular weight of 375.42 g/mol. Its IUPAC name is methyl 7-fluoro-1,1-dioxo-4-(4-propan-2-ylphenyl)-1λ6,4-benzothiazine-2-carboxylate.
| Compound Name | methyl 7-fluoro-1,1-dioxo-4-(4-propan-2-ylphenyl)-1λ6,4-benzothiazine-2-carboxylate |
|---|---|
| PubChem CID | 50927970 |
| Molecular Formula | C19H18FNO4S |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | methyl 7-fluoro-1,1-dioxo-4-(4-propan-2-ylphenyl)-1λ6,4-benzothiazine-2-carboxylate |
| SMILES | COC(=O)C1=CN(c2ccc(C(C)C)cc2)c2ccc(F)cc2S1(=O)=O |
| InChI | InChI=1S/C19H18FNO4S/c1-12(2)13-4-7-15(8-5-13)21-11-18(19(22)25-3)26(23,24)17-10-14(20)6-9-16(17)21/h4-12H,1-3H3 |
| InChIKey | HOROFVFOFYZAGC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|