C18H15FN2O5S — CID 91886960
methyl 4-(4-acetamidophenyl)-6-fluoro-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate (PubChem CID 91886960) has the molecular formula C18H15FN2O5S and a molecular weight of 390.39 g/mol. Its IUPAC name is methyl 4-(4-acetamidophenyl)-6-fluoro-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate.
| Compound Name | methyl 4-(4-acetamidophenyl)-6-fluoro-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate |
|---|---|
| PubChem CID | 91886960 |
| Molecular Formula | C18H15FN2O5S |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | methyl 4-(4-acetamidophenyl)-6-fluoro-1,1-dioxo-1λ6,4-benzothiazine-2-carboxylate |
| SMILES | COC(=O)C1=CN(c2ccc(NC(C)=O)cc2)c2cc(F)ccc2S1(=O)=O |
| InChI | InChI=1S/C18H15FN2O5S/c1-11(22)20-13-4-6-14(7-5-13)21-10-17(18(23)26-2)27(24,25)16-8-3-12(19)9-15(16)21/h3-10H,1-2H3,(H,20,22) |
| InChIKey | CHUFXRSYGYXNQN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|