C18H14BrNO5 — CID 164684431
dimethyl 4-(3-bromophenyl)-1,4-benzoxazine-2,6-dicarboxylate (PubChem CID 164684431) has the molecular formula C18H14BrNO5 and a molecular weight of 404.22 g/mol. Its IUPAC name is dimethyl 4-(3-bromophenyl)-1,4-benzoxazine-2,6-dicarboxylate.
| Compound Name | dimethyl 4-(3-bromophenyl)-1,4-benzoxazine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 164684431 |
| Molecular Formula | C18H14BrNO5 |
| Molecular Weight | 404.22 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | dimethyl 4-(3-bromophenyl)-1,4-benzoxazine-2,6-dicarboxylate |
| SMILES | COC(=O)C1=CN(c2cccc(Br)c2)c2cc(C(=O)OC)ccc2O1 |
| InChI | InChI=1S/C18H14BrNO5/c1-23-17(21)11-6-7-15-14(8-11)20(10-16(25-15)18(22)24-2)13-5-3-4-12(19)9-13/h3-10H,1-2H3 |
| InChIKey | DACIAQLORFMBMR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.22 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |