C27H26FNO4S — CID 46297270
[4-(4-butylphenyl)-6-fluoro-1,1-dioxo-1λ6,4-benzothiazin-2-yl]-(4-ethoxyphenyl)methanone (PubChem CID 46297270) has the molecular formula C27H26FNO4S and a molecular weight of 479.57 g/mol. Its IUPAC name is [4-(4-butylphenyl)-6-fluoro-1,1-dioxo-1λ6,4-benzothiazin-2-yl]-(4-ethoxyphenyl)methanone.
| Compound Name | [4-(4-butylphenyl)-6-fluoro-1,1-dioxo-1λ6,4-benzothiazin-2-yl]-(4-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 46297270 |
| Molecular Formula | C27H26FNO4S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | [4-(4-butylphenyl)-6-fluoro-1,1-dioxo-1λ6,4-benzothiazin-2-yl]-(4-ethoxyphenyl)methanone |
| SMILES | CCCCc1ccc(N2C=C(C(=O)c3ccc(OCC)cc3)S(=O)(=O)c3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C27H26FNO4S/c1-3-5-6-19-7-12-22(13-8-19)29-18-26(27(30)20-9-14-23(15-10-20)33-4-2)34(31,32)25-16-11-21(28)17-24(25)29/h7-18H,3-6H2,1-2H3 |
| InChIKey | WGOXWFFZYPCKST-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|