C26H23FN2O3S2 — CID 46297414
N-(3-ethylphenyl)-4-(3-fluorophenyl)-3-[methyl(phenyl)sulfamoyl]thiophene-2-carboxamide (PubChem CID 46297414) has the molecular formula C26H23FN2O3S2 and a molecular weight of 494.61 g/mol. Its IUPAC name is N-(3-ethylphenyl)-4-(3-fluorophenyl)-3-[methyl(phenyl)sulfamoyl]thiophene-2-carboxamide.
| Compound Name | N-(3-ethylphenyl)-4-(3-fluorophenyl)-3-[methyl(phenyl)sulfamoyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46297414 |
| Molecular Formula | C26H23FN2O3S2 |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | N-(3-ethylphenyl)-4-(3-fluorophenyl)-3-[methyl(phenyl)sulfamoyl]thiophene-2-carboxamide |
| SMILES | CCc1cccc(NC(=O)c2scc(-c3cccc(F)c3)c2S(=O)(=O)N(C)c2ccccc2)c1 |
| InChI | InChI=1S/C26H23FN2O3S2/c1-3-18-9-7-12-21(15-18)28-26(30)24-25(23(17-33-24)19-10-8-11-20(27)16-19)34(31,32)29(2)22-13-5-4-6-14-22/h4-17H,3H2,1-2H3,(H,28,30) |
| InChIKey | XUMODNIHQUJGNB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |