C24H19FN2O3S2 — CID 30849373
N-(3-fluorophenyl)-3-[methyl(phenyl)sulfamoyl]-4-phenylthiophene-2-carboxamide (PubChem CID 30849373) has the molecular formula C24H19FN2O3S2 and a molecular weight of 466.56 g/mol. Its IUPAC name is N-(3-fluorophenyl)-3-[methyl(phenyl)sulfamoyl]-4-phenylthiophene-2-carboxamide.
| Compound Name | N-(3-fluorophenyl)-3-[methyl(phenyl)sulfamoyl]-4-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 30849373 |
| Molecular Formula | C24H19FN2O3S2 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | N-(3-fluorophenyl)-3-[methyl(phenyl)sulfamoyl]-4-phenylthiophene-2-carboxamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1c(-c2ccccc2)csc1C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C24H19FN2O3S2/c1-27(20-13-6-3-7-14-20)32(29,30)23-21(17-9-4-2-5-10-17)16-31-22(23)24(28)26-19-12-8-11-18(25)15-19/h2-16H,1H3,(H,26,28) |
| InChIKey | ZVFGLBHFBBHEOF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |