C20H21N5O5S — CID 46297845
N-(4-acetamidophenyl)-5-[(4-ethoxyphenyl)sulfamoyl]-1H-pyrazole-3-carboxamide (PubChem CID 46297845) has the molecular formula C20H21N5O5S and a molecular weight of 443.49 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-5-[(4-ethoxyphenyl)sulfamoyl]-1H-pyrazole-3-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-5-[(4-ethoxyphenyl)sulfamoyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 46297845 |
| Molecular Formula | C20H21N5O5S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-(4-acetamidophenyl)-5-[(4-ethoxyphenyl)sulfamoyl]-1H-pyrazole-3-carboxamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cc(C(=O)Nc3ccc(NC(C)=O)cc3)n[nH]2)cc1 |
| InChI | InChI=1S/C20H21N5O5S/c1-3-30-17-10-8-16(9-11-17)25-31(28,29)19-12-18(23-24-19)20(27)22-15-6-4-14(5-7-15)21-13(2)26/h4-12,25H,3H2,1-2H3,(H,21,26)(H,22,27)(H,23,24) |
| InChIKey | QMRJKESNOIQABQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 142.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |