C24H25BrN4O2 — CID 46297974
N-[N-(3-bromophenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-4-butoxybenzamide (PubChem CID 46297974) has the molecular formula C24H25BrN4O2 and a molecular weight of 481.39 g/mol. Its IUPAC name is N-[N-(3-bromophenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-4-butoxybenzamide.
| Compound Name | N-[N-(3-bromophenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-4-butoxybenzamide |
|---|---|
| PubChem CID | 46297974 |
| Molecular Formula | C24H25BrN4O2 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | N-[N-(3-bromophenyl)-N'-(pyridin-4-ylmethyl)carbamimidoyl]-4-butoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)N/C(=N\Cc2ccncc2)Nc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C24H25BrN4O2/c1-2-3-15-31-22-9-7-19(8-10-22)23(30)29-24(27-17-18-11-13-26-14-12-18)28-21-6-4-5-20(25)16-21/h4-14,16H,2-3,15,17H2,1H3,(H2,27,28,29,30) |
| InChIKey | UDTUSNAYMWFGMU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|