C19H17ClFN5O2S — CID 46300766
N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl)acetamide (PubChem CID 46300766) has the molecular formula C19H17ClFN5O2S and a molecular weight of 433.90 g/mol. Its IUPAC name is N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl)acetamide.
| Compound Name | N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl)acetamide |
|---|---|
| PubChem CID | 46300766 |
| Molecular Formula | C19H17ClFN5O2S |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl)acetamide |
| SMILES | CC1CCc2c(sc3nnn(CC(=O)N/N=C/c4c(F)cccc4Cl)c(=O)c23)C1 |
| InChI | InChI=1S/C19H17ClFN5O2S/c1-10-5-6-11-15(7-10)29-18-17(11)19(28)26(25-24-18)9-16(27)23-22-8-12-13(20)3-2-4-14(12)21/h2-4,8,10H,5-7,9H2,1H3,(H,23,27)/b22-8+ |
| InChIKey | HMAIXUOELXLECD-GZIVZEMBSA-N |
| XLogP | 2.92 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|