C20H20BrN5O3S — CID 46300772
N-[(Z)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl)acetamide (PubChem CID 46300772) has the molecular formula C20H20BrN5O3S and a molecular weight of 490.38 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl)acetamide.
| Compound Name | N-[(Z)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl)acetamide |
|---|---|
| PubChem CID | 46300772 |
| Molecular Formula | C20H20BrN5O3S |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | N-[(Z)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]triazin-3-yl)acetamide |
| SMILES | COc1ccc(/C=N\NC(=O)Cn2nnc3sc4c(c3c2=O)CCC(C)C4)cc1Br |
| InChI | InChI=1S/C20H20BrN5O3S/c1-11-3-5-13-16(7-11)30-19-18(13)20(28)26(25-24-19)10-17(27)23-22-9-12-4-6-15(29-2)14(21)8-12/h4,6,8-9,11H,3,5,7,10H2,1-2H3,(H,23,27)/b22-9- |
| InChIKey | RHUSVWROEFIKQR-AFPJDJCSSA-N |
| XLogP | 2.90 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|