C23H23N5O3S2 — CID 46304207
prop-2-enyl 2-[3-[(5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanoylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 46304207) has the molecular formula C23H23N5O3S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is prop-2-enyl 2-[3-[(5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanoylamino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[3-[(5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanoylamino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 46304207 |
| Molecular Formula | C23H23N5O3S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | prop-2-enyl 2-[3-[(5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanoylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(NC(=O)CCSc2nnc3cc(C)c4cccc(C)c4n23)nc1C |
| InChI | InChI=1S/C23H23N5O3S2/c1-5-10-31-21(30)20-15(4)24-22(33-20)25-18(29)9-11-32-23-27-26-17-12-14(3)16-8-6-7-13(2)19(16)28(17)23/h5-8,12H,1,9-11H2,2-4H3,(H,24,25,29) |
| InChIKey | KYNREBDIXHSETB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|