C24H25N5O2S2 — CID 46304244
2-[3-[(5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 46304244) has the molecular formula C24H25N5O2S2 and a molecular weight of 479.63 g/mol. Its IUPAC name is 2-[3-[(5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[3-[(5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 46304244 |
| Molecular Formula | C24H25N5O2S2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 2-[3-[(5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1cc2nnc(SCCC(=O)Nc3sc4c(c3C(N)=O)CCCC4)n2c2c(C)cccc12 |
| InChI | InChI=1S/C24H25N5O2S2/c1-13-6-5-8-15-14(2)12-18-27-28-24(29(18)21(13)15)32-11-10-19(30)26-23-20(22(25)31)16-7-3-4-9-17(16)33-23/h5-6,8,12H,3-4,7,9-11H2,1-2H3,(H2,25,31)(H,26,30) |
| InChIKey | HXMHHWJVNPLYTC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |