C23H23N5O2S — CID 46304476
N-(3-cyano-4,5-dimethylfuran-2-yl)-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanamide (PubChem CID 46304476) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylfuran-2-yl)-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanamide.
| Compound Name | N-(3-cyano-4,5-dimethylfuran-2-yl)-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 46304476 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-(3-cyano-4,5-dimethylfuran-2-yl)-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanamide |
| SMILES | Cc1cc(C)c2c(c1)c(C)cc1nnc(SC(C)C(=O)Nc3oc(C)c(C)c3C#N)n12 |
| InChI | InChI=1S/C23H23N5O2S/c1-11-7-13(3)20-17(8-11)12(2)9-19-26-27-23(28(19)20)31-16(6)21(29)25-22-18(10-24)14(4)15(5)30-22/h7-9,16H,1-6H3,(H,25,29) |
| InChIKey | ALIMTBAUJSORTG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |