C31H34N2O7S — CID 4630603
ethyl 2-[2-[3-ethoxy-4-(3-methylbutoxy)phenyl]-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4630603) has the molecular formula C31H34N2O7S and a molecular weight of 578.69 g/mol. Its IUPAC name is ethyl 2-[2-[3-ethoxy-4-(3-methylbutoxy)phenyl]-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[2-[3-ethoxy-4-(3-methylbutoxy)phenyl]-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4630603 |
| Molecular Formula | C31H34N2O7S |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | ethyl 2-[2-[3-ethoxy-4-(3-methylbutoxy)phenyl]-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccccc3)C2c2ccc(OCCC(C)C)c(OCC)c2)nc1C |
| InChI | InChI=1S/C31H34N2O7S/c1-6-38-23-17-21(13-14-22(23)40-16-15-18(3)4)25-24(26(34)20-11-9-8-10-12-20)27(35)29(36)33(25)31-32-19(5)28(41-31)30(37)39-7-2/h8-14,17-18,25,34H,6-7,15-16H2,1-5H3 |
| InChIKey | OBCLEEOYWHLUGV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|