C17H20BrNO4 — CID 46307322
2-(2-amino-4-methylphenoxy)-1-(2-bromo-4,5-dimethoxyphenyl)ethanol (PubChem CID 46307322) has the molecular formula C17H20BrNO4 and a molecular weight of 382.25 g/mol. Its IUPAC name is 2-(2-amino-4-methylphenoxy)-1-(2-bromo-4,5-dimethoxyphenyl)ethanol.
| Compound Name | 2-(2-amino-4-methylphenoxy)-1-(2-bromo-4,5-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 46307322 |
| Molecular Formula | C17H20BrNO4 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 2-(2-amino-4-methylphenoxy)-1-(2-bromo-4,5-dimethoxyphenyl)ethanol |
| SMILES | COc1cc(Br)c(C(O)COc2ccc(C)cc2N)cc1OC |
| InChI | InChI=1S/C17H20BrNO4/c1-10-4-5-15(13(19)6-10)23-9-14(20)11-7-16(21-2)17(22-3)8-12(11)18/h4-8,14,20H,9,19H2,1-3H3 |
| InChIKey | XXRQQHISICNCJS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|