C17H21NO4 — CID 46307253
2-(2-aminophenoxy)-1-(2,5-dimethoxy-4-methylphenyl)ethanol (PubChem CID 46307253) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-(2-aminophenoxy)-1-(2,5-dimethoxy-4-methylphenyl)ethanol.
| Compound Name | 2-(2-aminophenoxy)-1-(2,5-dimethoxy-4-methylphenyl)ethanol |
|---|---|
| PubChem CID | 46307253 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-(2-aminophenoxy)-1-(2,5-dimethoxy-4-methylphenyl)ethanol |
| SMILES | COc1cc(C(O)COc2ccccc2N)c(OC)cc1C |
| InChI | InChI=1S/C17H21NO4/c1-11-8-17(21-3)12(9-16(11)20-2)14(19)10-22-15-7-5-4-6-13(15)18/h4-9,14,19H,10,18H2,1-3H3 |
| InChIKey | RLUWPQMKYXUQRF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|