C17H19NO4 — CID 46307410
2-(2-aminophenoxy)-1-(3,4-dimethoxyphenyl)propan-1-one (PubChem CID 46307410) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-(2-aminophenoxy)-1-(3,4-dimethoxyphenyl)propan-1-one.
| Compound Name | 2-(2-aminophenoxy)-1-(3,4-dimethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 46307410 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-(2-aminophenoxy)-1-(3,4-dimethoxyphenyl)propan-1-one |
| SMILES | COc1ccc(C(=O)C(C)Oc2ccccc2N)cc1OC |
| InChI | InChI=1S/C17H19NO4/c1-11(22-14-7-5-4-6-13(14)18)17(19)12-8-9-15(20-2)16(10-12)21-3/h4-11H,18H2,1-3H3 |
| InChIKey | SZZPKQMNZSEBPD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|