C18H21NO4 — CID 46307411
2-(2-aminophenoxy)-1-(3,4-dimethoxyphenyl)butan-1-one (PubChem CID 46307411) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-(2-aminophenoxy)-1-(3,4-dimethoxyphenyl)butan-1-one.
| Compound Name | 2-(2-aminophenoxy)-1-(3,4-dimethoxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 46307411 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-(2-aminophenoxy)-1-(3,4-dimethoxyphenyl)butan-1-one |
| SMILES | CCC(Oc1ccccc1N)C(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H21NO4/c1-4-14(23-15-8-6-5-7-13(15)19)18(20)12-9-10-16(21-2)17(11-12)22-3/h5-11,14H,4,19H2,1-3H3 |
| InChIKey | BFUNCTYSVZKNSG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|