C20H25NO2 — CID 46307367
2-(2-aminophenoxy)-1-(2,5-diethylphenyl)butan-1-one (PubChem CID 46307367) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-(2-aminophenoxy)-1-(2,5-diethylphenyl)butan-1-one.
| Compound Name | 2-(2-aminophenoxy)-1-(2,5-diethylphenyl)butan-1-one |
|---|---|
| PubChem CID | 46307367 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-(2-aminophenoxy)-1-(2,5-diethylphenyl)butan-1-one |
| SMILES | CCc1ccc(CC)c(C(=O)C(CC)Oc2ccccc2N)c1 |
| InChI | InChI=1S/C20H25NO2/c1-4-14-11-12-15(5-2)16(13-14)20(22)18(6-3)23-19-10-8-7-9-17(19)21/h7-13,18H,4-6,21H2,1-3H3 |
| InChIKey | DAPJAHBDSYOYGR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|