C16H14Cl2N2O2 — CID 46308197
2-[5-chloro-2-[(4-chlorophenoxy)methyl]benzimidazol-1-yl]ethanol (PubChem CID 46308197) has the molecular formula C16H14Cl2N2O2 and a molecular weight of 337.21 g/mol. Its IUPAC name is 2-[5-chloro-2-[(4-chlorophenoxy)methyl]benzimidazol-1-yl]ethanol.
| Compound Name | 2-[5-chloro-2-[(4-chlorophenoxy)methyl]benzimidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 46308197 |
| Molecular Formula | C16H14Cl2N2O2 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 2-[5-chloro-2-[(4-chlorophenoxy)methyl]benzimidazol-1-yl]ethanol |
| SMILES | OCCn1c(COc2ccc(Cl)cc2)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H14Cl2N2O2/c17-11-1-4-13(5-2-11)22-10-16-19-14-9-12(18)3-6-15(14)20(16)7-8-21/h1-6,9,21H,7-8,10H2 |
| InChIKey | MJYUVLOVNSTJAM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |