C26H36ClN3O — CID 46309703
N-butyl-N-[3-[5-chloro-2-[(4-methylphenoxy)methyl]benzimidazol-1-yl]propyl]butan-1-amine (PubChem CID 46309703) has the molecular formula C26H36ClN3O and a molecular weight of 442.05 g/mol. Its IUPAC name is N-butyl-N-[3-[5-chloro-2-[(4-methylphenoxy)methyl]benzimidazol-1-yl]propyl]butan-1-amine.
| Compound Name | N-butyl-N-[3-[5-chloro-2-[(4-methylphenoxy)methyl]benzimidazol-1-yl]propyl]butan-1-amine |
|---|---|
| PubChem CID | 46309703 |
| Molecular Formula | C26H36ClN3O |
| Molecular Weight | 442.05 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | N-butyl-N-[3-[5-chloro-2-[(4-methylphenoxy)methyl]benzimidazol-1-yl]propyl]butan-1-amine |
| SMILES | CCCCN(CCCC)CCCn1c(COc2ccc(C)cc2)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C26H36ClN3O/c1-4-6-15-29(16-7-5-2)17-8-18-30-25-14-11-22(27)19-24(25)28-26(30)20-31-23-12-9-21(3)10-13-23/h9-14,19H,4-8,15-18,20H2,1-3H3 |
| InChIKey | HXQCBSRFPQHXHL-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.05 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |