C25H23F3N2S — CID 46310833
1-(2-methylpropyl)-2-[phenyl(phenylsulfanyl)methyl]-5-(trifluoromethyl)benzimidazole (PubChem CID 46310833) has the molecular formula C25H23F3N2S and a molecular weight of 440.53 g/mol. Its IUPAC name is 1-(2-methylpropyl)-2-[phenyl(phenylsulfanyl)methyl]-5-(trifluoromethyl)benzimidazole.
| Compound Name | 1-(2-methylpropyl)-2-[phenyl(phenylsulfanyl)methyl]-5-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 46310833 |
| Molecular Formula | C25H23F3N2S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 1-(2-methylpropyl)-2-[phenyl(phenylsulfanyl)methyl]-5-(trifluoromethyl)benzimidazole |
| SMILES | CC(C)Cn1c(C(Sc2ccccc2)c2ccccc2)nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C25H23F3N2S/c1-17(2)16-30-22-14-13-19(25(26,27)28)15-21(22)29-24(30)23(18-9-5-3-6-10-18)31-20-11-7-4-8-12-20/h3-15,17,23H,16H2,1-2H3 |
| InChIKey | FJKXACIQRCATAZ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |