C25H27N4O4+ — CID 4631609
[amino-[3-[2-methoxycarbonyl-3-[[4-(1-oxidopyridin-1-ium-4-yl)benzoyl]amino]butyl]phenyl]methylidene]azanium (PubChem CID 4631609) has the molecular formula C25H27N4O4+ and a molecular weight of 447.52 g/mol. Its IUPAC name is [amino-[3-[2-methoxycarbonyl-3-[[4-(1-oxidopyridin-1-ium-4-yl)benzoyl]amino]butyl]phenyl]methylidene]azanium.
| Compound Name | [amino-[3-[2-methoxycarbonyl-3-[[4-(1-oxidopyridin-1-ium-4-yl)benzoyl]amino]butyl]phenyl]methylidene]azanium |
|---|---|
| PubChem CID | 4631609 |
| Molecular Formula | C25H27N4O4+ |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | [amino-[3-[2-methoxycarbonyl-3-[[4-(1-oxidopyridin-1-ium-4-yl)benzoyl]amino]butyl]phenyl]methylidene]azanium |
| SMILES | COC(=O)C(Cc1cccc(C(N)=[NH2+])c1)C(C)NC(=O)c1ccc(-c2cc[n+]([O-])cc2)cc1 |
| InChI | InChI=1S/C25H26N4O4/c1-16(22(25(31)33-2)15-17-4-3-5-21(14-17)23(26)27)28-24(30)20-8-6-18(7-9-20)19-10-12-29(32)13-11-19/h3-14,16,22H,15H2,1-2H3,(H3,26,27)(H,28,30)/p+1 |
| InChIKey | PFGVNLZDWRZPJW-UHFFFAOYSA-O |
| XLogP | 0.60 |
| TPSA | 133.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|