C16H11ClN2O2S — CID 46316400
2,4-dipyridin-4-ylbenzenesulfonyl chloride (PubChem CID 46316400) has the molecular formula C16H11ClN2O2S and a molecular weight of 330.80 g/mol. Its IUPAC name is 2,4-dipyridin-4-ylbenzenesulfonyl chloride.
| Compound Name | 2,4-dipyridin-4-ylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 46316400 |
| Molecular Formula | C16H11ClN2O2S |
| Molecular Weight | 330.80 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 2,4-dipyridin-4-ylbenzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(-c2ccncc2)cc1-c1ccncc1 |
| InChI | InChI=1S/C16H11ClN2O2S/c17-22(20,21)16-2-1-14(12-3-7-18-8-4-12)11-15(16)13-5-9-19-10-6-13/h1-11H |
| InChIKey | SHGQPVMTRNUBQT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.80 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |