C25H35N5O3S — CID 46319302
N-(3-oxo-3-piperazin-1-ylpropyl)-N-[2-(4-phenylpiperazin-1-yl)ethyl]benzenesulfonamide (PubChem CID 46319302) has the molecular formula C25H35N5O3S and a molecular weight of 485.65 g/mol. Its IUPAC name is N-(3-oxo-3-piperazin-1-ylpropyl)-N-[2-(4-phenylpiperazin-1-yl)ethyl]benzenesulfonamide.
| Compound Name | N-(3-oxo-3-piperazin-1-ylpropyl)-N-[2-(4-phenylpiperazin-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46319302 |
| Molecular Formula | C25H35N5O3S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | N-(3-oxo-3-piperazin-1-ylpropyl)-N-[2-(4-phenylpiperazin-1-yl)ethyl]benzenesulfonamide |
| SMILES | O=C(CCN(CCN1CCN(c2ccccc2)CC1)S(=O)(=O)c1ccccc1)N1CCNCC1 |
| InChI | InChI=1S/C25H35N5O3S/c31-25(29-15-12-26-13-16-29)11-14-30(34(32,33)24-9-5-2-6-10-24)22-19-27-17-20-28(21-18-27)23-7-3-1-4-8-23/h1-10,26H,11-22H2 |
| InChIKey | ZLMPAWQUAVFKFO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |