C25H29N5O3S — CID 46320178
5-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutyl]-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 46320178) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is 5-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutyl]-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutyl]-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 46320178 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 5-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutyl]-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)CCCc3nnc(C(=O)Nc4ccc(C)cc4)s3)CC2)cc1 |
| InChI | InChI=1S/C25H29N5O3S/c1-18-6-8-19(9-7-18)26-24(32)25-28-27-22(34-25)4-3-5-23(31)30-16-14-29(15-17-30)20-10-12-21(33-2)13-11-20/h6-13H,3-5,14-17H2,1-2H3,(H,26,32) |
| InChIKey | OUTSNHGBULSGOW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|