C12H17N6O8P — CID 4632020
[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2-azaniumylacetyl) phosphate (PubChem CID 4632020) has the molecular formula C12H17N6O8P and a molecular weight of 404.28 g/mol. Its IUPAC name is [5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2-azaniumylacetyl) phosphate.
| Compound Name | [5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2-azaniumylacetyl) phosphate |
|---|---|
| PubChem CID | 4632020 |
| Molecular Formula | C12H17N6O8P |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | [5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2-azaniumylacetyl) phosphate |
| SMILES | Nc1ncnc2c1ncn2C1OC(COP(=O)([O-])OC(=O)C[NH3+])C(O)C1O |
| InChI | InChI=1S/C12H17N6O8P/c13-1-6(19)26-27(22,23)24-2-5-8(20)9(21)12(25-5)18-4-17-7-10(14)15-3-16-11(7)18/h3-5,8-9,12,20-21H,1-2,13H2,(H,22,23)(H2,14,15,16) |
| InChIKey | HROXHMRQKGGIFT-UHFFFAOYSA-N |
| XLogP | -3.70 |
| TPSA | 222.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|